Products 1820664-86-5
CAS 1820664-86-5 is the registry number for Methyl 5-bromo-3,6-dichloropyridine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g.
Methyl 5-bromo-3,6-dichloropyridine-2-carboxylate (CAS 1820664-86-5) is a chemical compound with the molecular formula C7H4BrCl2NO2 and a molecular weight of 284.92 g/mol. IUPAC name: methyl 5-bromo-3,6-dichloropyridine-2-carboxylate. InChIKey: MAISURFCXQJBHB-UHFFFAOYSA-N.
| Molecular formula | C7H4BrCl2NO2 |
|---|---|
| Molecular weight | 284.92 g/mol |
| IUPAC name | methyl 5-bromo-3,6-dichloropyridine-2-carboxylate |
| InChIKey | MAISURFCXQJBHB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=C(C=C1Cl)Br)Cl |
Computed by PubChem (NCBI)