cas: 1107627-14-4 — see every product listed under this CAS number, including other names
Methyl 2-bromo-3-chlorobenzoate 95% (CAS 1107627-14-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A235087-1g |
| cas | 1107627-14-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 381.50 Pln | |
| Ambeed | 25g | 1193.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A235087 |
Methyl 2-bromo-3-chlorobenzoate (CAS 1107627-14-4) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: methyl 2-bromo-3-chlorobenzoate. InChIKey: DBKFYOHGPURQCZ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | methyl 2-bromo-3-chlorobenzoate |
| InChIKey | DBKFYOHGPURQCZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)Cl)Br |
Computed by PubChem (NCBI)