Methyl 2-bromo-5-(trifluoromethoxy)benzoate 98%
cas: 1150114-81-0 — see every product listed under this CAS number, including other names
Methyl 2-bromo-5-(trifluoromethoxy)benzoate 98% (CAS 1150114-81-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A112417-100mg |
| cas | 1150114-81-0 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 1093.50 Pln | |
| Ambeed | 25g | 3646.69 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A112417 |
Methyl 2-bromo-5-(trifluoromethoxy)benzoate (CAS 1150114-81-0) is a chemical compound with the molecular formula C9H6BrF3O3 and a molecular weight of 299.04 g/mol. IUPAC name: methyl 2-bromo-5-(trifluoromethoxy)benzoate. InChIKey: IETHWZNVMZUZKC-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O3 |
|---|---|
| Molecular weight | 299.04 g/mol |
| IUPAC name | methyl 2-bromo-5-(trifluoromethoxy)benzoate |
| InChIKey | IETHWZNVMZUZKC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)OC(F)(F)F)Br |
Computed by PubChem (NCBI)