cas: 104253-44-3 — see every product listed under this CAS number, including other names
Methyl 2-chloro-4-hydroxybenzoate, 98% (CAS 104253-44-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225162-1G |
| cas | 104253-44-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 549.82 Pln | |
| Fluorochem | 10g | 1008.00 Pln | |
| Fluorochem | 25g | 1997.23 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 2-chloro-4-hydroxybenzoate (CAS 104253-44-3) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: methyl 2-chloro-4-hydroxybenzoate. InChIKey: BJZFMXJQJZUATE-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | methyl 2-chloro-4-hydroxybenzoate |
| InChIKey | BJZFMXJQJZUATE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)O)Cl |
Computed by PubChem (NCBI)