cas: 923283-86-7 — see every product listed under this CAS number, including other names
Methyl 2-isopropyl-4-nitro-pyrazole-3-carboxylate, 97% (CAS 923283-86-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A809662-10g |
| cas | 923283-86-7 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 18753.70 Pln | |
| AmBeed | 5g | 11280.22 Pln | |
| Fluorochem | 100mg | 909.07 Pln | |
| Fluorochem | 250mg | 1450.55 Pln | |
| Fluorochem | 500mg | 2372.10 Pln | |
| Fluorochem | 1g | 3512.32 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 4-nitro-1-propan-2-ylpyrazole-5-carboxylate (CAS 923283-86-7) is a chemical compound with the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. IUPAC name: methyl 4-nitro-1-propan-2-ylpyrazole-5-carboxylate. InChIKey: ZETGPKPUVRMDBP-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O4 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | methyl 4-nitro-1-propan-2-ylpyrazole-5-carboxylate |
| InChIKey | ZETGPKPUVRMDBP-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=C(C=N1)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)