cas: 72730-39-3 — see every product listed under this CAS number, including other names
Methyl 2-mercaptobenzo[d]oxazole-5-carboxylate, 95%, 95% (CAS 72730-39-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FEEW-1g |
| cas | 72730-39-3 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1653.20 Pln | |
| Chemat | 5g | 4821.20 Pln | |
| Chemat | 10g | 7192.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-sulfanylidene-3H-1,3-benzoxazole-5-carboxylate (CAS 72730-39-3) is a chemical compound with the molecular formula C9H7NO3S and a molecular weight of 209.22 g/mol. IUPAC name: methyl 2-sulfanylidene-3H-1,3-benzoxazole-5-carboxylate. InChIKey: JMJGRFGKJKXVPP-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3S |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | methyl 2-sulfanylidene-3H-1,3-benzoxazole-5-carboxylate |
| InChIKey | JMJGRFGKJKXVPP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)OC(=S)N2 |
Computed by PubChem (NCBI)