CAS 945-03-9 is the registry number for (2-Oxo-1,3-benzothiazol-3(2h)-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(2-oxo-1,3-benzothiazol-3-yl)acetic acid (CAS 945-03-9) is a chemical compound with the molecular formula C9H7NO3S and a molecular weight of 209.22 g/mol. IUPAC name: 2-(2-oxo-1,3-benzothiazol-3-yl)acetic acid. InChIKey: SXOCCTHWTPGZHT-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3S |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | 2-(2-oxo-1,3-benzothiazol-3-yl)acetic acid |
| InChIKey | SXOCCTHWTPGZHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C(=O)S2)CC(=O)O |
Computed by PubChem (NCBI)