Methyl 2-methyl-3-oxo-3-(pyridin-4-yl)propanoate, 95%
cas: 16658-70-1 — see every product listed under this CAS number, including other names
Methyl 2-methyl-3-oxo-3-(pyridin-4-yl)propanoate, 95% (CAS 16658-70-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1684114-100mg |
| cas | 16658-70-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 320.31 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 1188.06 Pln | |
| BLDpharm | 100mg | 308.80 Pln | |
| BLDpharm | 250mg | 469.86 Pln | |
| BLDpharm | 1g | 1164.06 Pln | |
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 1g | 1014.80 Pln | |
| Fluorochem | 100mg | 482.14 Pln | |
| Fluorochem | 250mg | 747.67 Pln | |
| Fluorochem | 1g | 1872.28 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 2-methyl-3-oxo-3-pyridin-4-ylpropanoate (CAS 16658-70-1) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: methyl 2-methyl-3-oxo-3-pyridin-4-ylpropanoate. InChIKey: JAWSNMBMRBJGCZ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | methyl 2-methyl-3-oxo-3-pyridin-4-ylpropanoate |
| InChIKey | JAWSNMBMRBJGCZ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=NC=C1)C(=O)OC |
Computed by PubChem (NCBI)