cas: 29333-41-3 — see every product listed under this CAS number, including other names
Methyl 3,5-bis(bromomethyl)benzoate, 97%, 97% (CAS 29333-41-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113Y40-50mg |
| cas | 29333-41-3 |
| size | 50mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 208.40 Pln | |
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 904.40 Pln | |
| Chemat | 5g | 3400.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 3,5-bis(bromomethyl)benzoate (CAS 29333-41-3) is a chemical compound with the molecular formula C10H10Br2O2 and a molecular weight of 321.99 g/mol. IUPAC name: methyl 3,5-bis(bromomethyl)benzoate. InChIKey: VKDYWLKLAIJZPL-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2O2 |
|---|---|
| Molecular weight | 321.99 g/mol |
| IUPAC name | methyl 3,5-bis(bromomethyl)benzoate |
| InChIKey | VKDYWLKLAIJZPL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)CBr)CBr |
Computed by PubChem (NCBI)