cas: 22027-50-5 — see every product listed under this CAS number, including other names
Methyl 3-(4-methoxyphenyl)-3-oxo-propionate 98% (CAS 22027-50-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A187794-5g |
| cas | 22027-50-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 654.06 Pln | |
| Ambeed | 500g | 2867.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A187794 |
Methyl 3-(4-methoxyphenyl)-3-oxopropanoate (CAS 22027-50-5) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: methyl 3-(4-methoxyphenyl)-3-oxopropanoate. InChIKey: VXXOASOINNOPGR-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | methyl 3-(4-methoxyphenyl)-3-oxopropanoate |
| InChIKey | VXXOASOINNOPGR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)CC(=O)OC |
Computed by PubChem (NCBI)