cas: 834884-82-1 — see every product listed under this CAS number, including other names
Methyl 3-(6-formylpyridin-2-yl)benzoate, 98%, 98% (CAS 834884-82-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RPO-100mg |
| cas | 834884-82-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 448.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-(6-formyl-2-pyridinyl)benzoate (CAS 834884-82-1) is a chemical compound with the molecular formula C14H11NO3 and a molecular weight of 241.24 g/mol. IUPAC name: methyl 3-(6-formyl-2-pyridinyl)benzoate. InChIKey: JDCVVFJRIBJMGT-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | methyl 3-(6-formyl-2-pyridinyl)benzoate |
| InChIKey | JDCVVFJRIBJMGT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=CC=CC(=N2)C=O |
Computed by PubChem (NCBI)