cas: 61859-96-9 — see every product listed under this CAS number, including other names
Methyl 3-(trifluoromethyl)-1H-pyrazole-4-carboxylate 95% (CAS 61859-96-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A238366-100mg |
| cas | 61859-96-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 882.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A238366 |
Methyl 5-(trifluoromethyl)-1H-pyrazole-4-carboxylate (CAS 61859-96-9) is a chemical compound with the molecular formula C6H5F3N2O2 and a molecular weight of 194.11 g/mol. IUPAC name: methyl 5-(trifluoromethyl)-1H-pyrazole-4-carboxylate. InChIKey: QWSUIVAZSMPWAO-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O2 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | methyl 5-(trifluoromethyl)-1H-pyrazole-4-carboxylate |
| InChIKey | QWSUIVAZSMPWAO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(NN=C1)C(F)(F)F |
Computed by PubChem (NCBI)