cas: 1206727-13-0 — see every product listed under this CAS number, including other names
Methyl 3-Amino-3-(3-hydroxyphenyl)propanoate Hydrochloride, >95%, >95% (CAS 1206727-13-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RQX-100mg |
| cas | 1206727-13-0 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 554.00 Pln | |
| Chemat | 250mg | 640.40 Pln | |
| Chemat | 1g | 1350.80 Pln | |
| Chemat | 5g | 3486.80 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride (CAS 1206727-13-0) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl 3-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride. InChIKey: ISRJRRVWAPZDPY-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl 3-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride |
| InChIKey | ISRJRRVWAPZDPY-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1=CC(=CC=C1)O)N.Cl |
Computed by PubChem (NCBI)