cas: 24812-89-3 — see every product listed under this CAS number, including other names
Methyl 3-amino-2,4-dimethylbenzoate, 98% (CAS 24812-89-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F232912-250MG |
| cas | 24812-89-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 1096.51 Pln | |
| Fluorochem | 10g | 2132.60 Pln | |
| Fluorochem | 25g | 4996.18 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-amino-2,4-dimethylbenzoate (CAS 24812-89-3) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: methyl 3-amino-2,4-dimethylbenzoate. InChIKey: VXCDYRLZDFQUCJ-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | methyl 3-amino-2,4-dimethylbenzoate |
| InChIKey | VXCDYRLZDFQUCJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)OC)C)N |
Computed by PubChem (NCBI)