Products 24812-89-3
CAS 24812-89-3 appears in our catalog under these names: Methyl 3-amino-2,4-dimethylbenzoate, 95%, Methyl 3-amino-2,4-dimethylbenzoate 96%, Methyl 3-amino-2,4-dimethylbenzoate, 98%, Methyl 3-amino-2，4-dimethylbenzoate, 96%, 96%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg, 25g.
Methyl 3-amino-2,4-dimethylbenzoate (CAS 24812-89-3) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: methyl 3-amino-2,4-dimethylbenzoate. InChIKey: VXCDYRLZDFQUCJ-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | methyl 3-amino-2,4-dimethylbenzoate |
| InChIKey | VXCDYRLZDFQUCJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)OC)C)N |
Computed by PubChem (NCBI)
Synonyms:
Methyl 3-amino-2,4-dimethylbenzoate, methyl 3-amino-2,4-dimethyl-benzoate, Benzoic acid, 3-amino-2,4-dimethyl-, methyl ester, Benzoic acid, 3-?amino-?2,?4-?dimethyl-?, methyl ester, 3-Amino-2,4-dimethyl-benzoic acid methyl ester, Methyl3-amino-2,4-dimethylbenzoate, VXCDYRLZDFQUCJ-UHFFFAOYSA-N