cas: 24812-89-3 — see every product listed under this CAS number, including other names
Methyl 3-amino-2,4-dimethylbenzoate, 96%, 96% (CAS 24812-89-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113PIF-100mg |
| cas | 24812-89-3 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 707.60 Pln | |
| Chemat | 25g | 3016.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-amino-2,4-dimethylbenzoate (CAS 24812-89-3) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: methyl 3-amino-2,4-dimethylbenzoate. InChIKey: VXCDYRLZDFQUCJ-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | methyl 3-amino-2,4-dimethylbenzoate |
| InChIKey | VXCDYRLZDFQUCJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)OC)C)N |
Computed by PubChem (NCBI)