CAS 1261647-99-7 appears in our catalog under these names: Methyl 3-amino-2-nitrobenzoate, 95%, 95%, METHYL 3-AMINO-2-NITROBENZOATE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
Methyl 3-amino-2-nitrobenzoate (CAS 1261647-99-7) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: methyl 3-amino-2-nitrobenzoate. InChIKey: BVWSKJRBYYNACC-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | methyl 3-amino-2-nitrobenzoate |
| InChIKey | BVWSKJRBYYNACC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)