Methyl 3-amino-2-nitrobenzoate, 95%
cas: 1261647-99-7 — see every product listed under this CAS number, including other names
Methyl 3-amino-2-nitrobenzoate, 95% (CAS 1261647-99-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A757063-250mg |
| cas | 1261647-99-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 442.69 Pln | |
| Ambeed | 1g | 748.62 Pln | |
| Ambeed | 5g | 2406.25 Pln | |
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 1874.00 Pln | |
| BLDpharm | 100mg | 286.59 Pln | |
| BLDpharm | 250mg | 436.54 Pln | |
| BLDpharm | 1g | 803.08 Pln | |
| BLDpharm | 5g | 2585.78 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 3-amino-2-nitrobenzoate (CAS 1261647-99-7) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: methyl 3-amino-2-nitrobenzoate. InChIKey: BVWSKJRBYYNACC-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | methyl 3-amino-2-nitrobenzoate |
| InChIKey | BVWSKJRBYYNACC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)
