cas: 35212-88-5 — see every product listed under this CAS number, including other names
Methyl 3-amino-4-methoxybenzo[b]thiophene-2-carboxylate, 98% (CAS 35212-88-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F453852-100MG |
| cas | 35212-88-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 299.91 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1106.92 Pln | |
| Fluorochem | 5g | 4267.27 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-amino-4-methoxy-1-benzothiophene-2-carboxylate (CAS 35212-88-5) is a chemical compound with the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. IUPAC name: methyl 3-amino-4-methoxy-1-benzothiophene-2-carboxylate. InChIKey: RTQFKIXDQUQACB-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | methyl 3-amino-4-methoxy-1-benzothiophene-2-carboxylate |
| InChIKey | RTQFKIXDQUQACB-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC=C1)SC(=C2N)C(=O)OC |
Computed by PubChem (NCBI)