cas: 1036380-75-2 — see every product listed under this CAS number, including other names
Methyl 3-amino-5-bromobenzo[b]thiophene-2-carboxylate 98+% (CAS 1036380-75-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A339937-100mg |
| cas | 1036380-75-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 298.06 Pln | |
| Ambeed | 5g | 1138.00 Pln |
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A339937 |
Methyl 3-amino-5-bromo-1-benzothiophene-2-carboxylate (CAS 1036380-75-2) is a chemical compound with the molecular formula C10H8BrNO2S and a molecular weight of 286.15 g/mol. IUPAC name: methyl 3-amino-5-bromo-1-benzothiophene-2-carboxylate. InChIKey: WJWGIMBQYSUCBO-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2S |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | methyl 3-amino-5-bromo-1-benzothiophene-2-carboxylate |
| InChIKey | WJWGIMBQYSUCBO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(S1)C=CC(=C2)Br)N |
Computed by PubChem (NCBI)