CAS 23218-93-1 appears in our catalog under these names: Methyl 3-amino-5-nitrobenzoate, 97%, 97%, 3-Amino-5-nitrobenzoic acid methyl ester, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg, 500mg.
Methyl 3-amino-5-nitrobenzoate (CAS 23218-93-1) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: methyl 3-amino-5-nitrobenzoate. InChIKey: HZVBRLJDOZZHFL-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | methyl 3-amino-5-nitrobenzoate |
| InChIKey | HZVBRLJDOZZHFL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)