cas: 113899-36-8 — see every product listed under this CAS number, including other names
Methyl 3-amino-5-nitrothiophene-2-carboxylate, 97%, 97% (CAS 113899-36-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111A1X-100mg |
| cas | 113899-36-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 616.40 Pln | |
| Chemat | 1g | 1226.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 3-amino-5-nitrothiophene-2-carboxylate (CAS 113899-36-8) is a chemical compound with the molecular formula C6H6N2O4S and a molecular weight of 202.19 g/mol. IUPAC name: methyl 3-amino-5-nitrothiophene-2-carboxylate. InChIKey: WUOQQUBKJDJZJY-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4S |
|---|---|
| Molecular weight | 202.19 g/mol |
| IUPAC name | methyl 3-amino-5-nitrothiophene-2-carboxylate |
| InChIKey | WUOQQUBKJDJZJY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(S1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)