CAS 206551-41-9 appears in our catalog under these names: Methyl 3–bromo–2–fluorobenzoate, Methyl 3-bromo-2-fluorobenzoate, 98% , Methyl 3-Bromo-2-fluorobenzoate, >98.0%(GC), Methyl 3-bromo-2-fluorobenzoate, Methyl 3-bromo-2-fluorobenzoate, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 50g, 250mg, 10g, 500g.
Methyl 3-bromo-2-fluorobenzoate (CAS 206551-41-9) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: methyl 3-bromo-2-fluorobenzoate. InChIKey: ZWOFHFOFKBYRHV-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | methyl 3-bromo-2-fluorobenzoate |
| InChIKey | ZWOFHFOFKBYRHV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)Br)F |
Computed by PubChem (NCBI)