cas: 327056-75-7 — see every product listed under this CAS number, including other names
Methyl 3-chloro-5-fluorobenzoate, 98% (CAS 327056-75-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F236517-1G |
| cas | 327056-75-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 393.63 Pln | |
| Fluorochem | 10g | 669.57 Pln | |
| Fluorochem | 25g | 1263.11 Pln | |
| Fluorochem | 100g | 4699.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-chloro-5-fluorobenzoate (CAS 327056-75-7) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: methyl 3-chloro-5-fluorobenzoate. InChIKey: DOZOMYSFEVYLAU-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | methyl 3-chloro-5-fluorobenzoate |
| InChIKey | DOZOMYSFEVYLAU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)Cl)F |
Computed by PubChem (NCBI)