Methyl 3-cyano-4,6-dimethylpicolinate, 97%
cas: 2168928-39-8 — see every product listed under this CAS number, including other names
Methyl 3-cyano-4,6-dimethylpicolinate, 97% (CAS 2168928-39-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2251686-250mg |
| cas | 2168928-39-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 509.44 Pln | |
| Ambeed | 1g | 1249.25 Pln | |
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 250mg | 443.60 Pln | |
| Chemat | 1g | 1058.00 Pln | |
| Chemat | 5g | 2042.00 Pln | |
| Chemat | 10g | 3280.40 Pln | |
| Chemat | 25g | 5675.60 Pln | |
| BLDpharm | 100mg | 319.91 Pln | |
| BLDpharm | 250mg | 542.06 Pln | |
| BLDpharm | 1g | 1341.77 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 3-cyano-4,6-dimethylpyridine-2-carboxylate (CAS 2168928-39-8) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: methyl 3-cyano-4,6-dimethylpyridine-2-carboxylate. InChIKey: XCMMSTIMEUFUPZ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | methyl 3-cyano-4,6-dimethylpyridine-2-carboxylate |
| InChIKey | XCMMSTIMEUFUPZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C#N)C(=O)OC)C |
Computed by PubChem (NCBI)