Products 2168928-39-8
CAS 2168928-39-8 is the registry number for Methyl 3-Cyano-4,6-dimethylpicolinate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
Methyl 3-cyano-4,6-dimethylpyridine-2-carboxylate (CAS 2168928-39-8) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: methyl 3-cyano-4,6-dimethylpyridine-2-carboxylate. InChIKey: XCMMSTIMEUFUPZ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | methyl 3-cyano-4,6-dimethylpyridine-2-carboxylate |
| InChIKey | XCMMSTIMEUFUPZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C#N)C(=O)OC)C |
Computed by PubChem (NCBI)