cas: 942077-15-8 — see every product listed under this CAS number, including other names
Methyl 3-cyano-5-(trifluoromethyl)benzoate (CAS 942077-15-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F778610-100MG |
| cas | 942077-15-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 341.56 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 924.69 Pln | |
| Fluorochem | 5g | 2923.99 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 3-cyano-5-(trifluoromethyl)benzoate (CAS 942077-15-8) is a chemical compound with the molecular formula C10H6F3NO2 and a molecular weight of 229.15 g/mol. IUPAC name: methyl 3-cyano-5-(trifluoromethyl)benzoate. InChIKey: BGUJITPVPBBWEW-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO2 |
|---|---|
| Molecular weight | 229.15 g/mol |
| IUPAC name | methyl 3-cyano-5-(trifluoromethyl)benzoate |
| InChIKey | BGUJITPVPBBWEW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)C#N)C(F)(F)F |
Computed by PubChem (NCBI)