cas: 55076-32-9 — see every product listed under this CAS number, including other names
Methyl 3-hydroxy-5-nitrobenzoate, 97% (CAS 55076-32-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F242777-250MG |
| cas | 55076-32-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 690.40 Pln | |
| Fluorochem | 5g | 2236.73 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-hydroxy-5-nitrobenzoate (CAS 55076-32-9) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: methyl 3-hydroxy-5-nitrobenzoate. InChIKey: HTYJYEKZUXJKKW-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | methyl 3-hydroxy-5-nitrobenzoate |
| InChIKey | HTYJYEKZUXJKKW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)