Methyl 4-(benzylcarbamoyl)cubane-1-carboxylate, 97%
cas: 2828439-85-4 — see every product listed under this CAS number, including other names
Methyl 4-(benzylcarbamoyl)cubane-1-carboxylate, 97% (CAS 2828439-85-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1538757-100mg |
| cas | 2828439-85-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 971.12 Pln | |
| Ambeed | 250mg | 1499.56 Pln | |
| Ambeed | 1g | 3229.50 Pln | |
| Ambeed | 5g | 12713.56 Pln | |
| BLDpharm | 100mg | 947.47 Pln | |
| BLDpharm | 250mg | 1469.51 Pln | |
| BLDpharm | 1g | 3163.36 Pln | |
| BLDpharm | 5g | 12454.53 Pln | |
| Chemat | 100mg | 880.40 Pln | |
| Chemat | 250mg | 1590.80 Pln | |
| Chemat | 1g | 3362.00 Pln | |
| Chemat | 5g | 13254.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 4-(benzylcarbamoyl)cubane-1-carboxylate (CAS 2828439-85-4) is a chemical compound with the molecular formula C18H17NO3 and a molecular weight of 295.3 g/mol. IUPAC name: methyl 4-(benzylcarbamoyl)cubane-1-carboxylate. InChIKey: DOTAPOKNPDZXTO-UHFFFAOYSA-N.
| Molecular formula | C18H17NO3 |
|---|---|
| Molecular weight | 295.3 g/mol |
| IUPAC name | methyl 4-(benzylcarbamoyl)cubane-1-carboxylate |
| InChIKey | DOTAPOKNPDZXTO-UHFFFAOYSA-N |
| SMILES | COC(=O)C12C3C4C1C5C2C3C45C(=O)NCC6=CC=CC=C6 |
Computed by PubChem (NCBI)