Products 1417984-61-2

CAS 1417984-61-2 is the registry number for 2-(5-(Benzyloxy)-6-methyl-1h-indol-3-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(6-methyl-5-phenylmethoxy-1H-indol-3-yl)acetic acid (CAS 1417984-61-2) is a chemical compound with the molecular formula C18H17NO3 and a molecular weight of 295.3 g/mol. IUPAC name: 2-(6-methyl-5-phenylmethoxy-1H-indol-3-yl)acetic acid. InChIKey: JZZZQJCJGDDKFZ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H17NO3
Molecular weight295.3 g/mol
IUPAC name2-(6-methyl-5-phenylmethoxy-1H-indol-3-yl)acetic acid
InChIKeyJZZZQJCJGDDKFZ-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1OCC3=CC=CC=C3)C(=CN2)CC(=O)O

Computed by PubChem (NCBI)