CAS 132105-71-6 appears in our catalog under these names: 1-Benzyl-5-methoxy-2-methyl-1h-indole-3-carboxylic acid, 95%, 1-Benzyl-5-methoxy-2-methyl-1H-indole-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 0,5g.
1-benzyl-5-methoxy-2-methylindole-3-carboxylic acid (CAS 132105-71-6) is a chemical compound with the molecular formula C18H17NO3 and a molecular weight of 295.3 g/mol. IUPAC name: 1-benzyl-5-methoxy-2-methylindole-3-carboxylic acid. InChIKey: UDXINIVAVPGBJW-UHFFFAOYSA-N.
| Molecular formula | C18H17NO3 |
|---|---|
| Molecular weight | 295.3 g/mol |
| IUPAC name | 1-benzyl-5-methoxy-2-methylindole-3-carboxylic acid |
| InChIKey | UDXINIVAVPGBJW-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1CC3=CC=CC=C3)C=CC(=C2)OC)C(=O)O |
Computed by PubChem (NCBI)