cas: 152628-01-8 — see every product listed under this CAS number, including other names
Methyl 4-(butyrylamino)-3-methyl-5-nitrobenzoate 97% (CAS 152628-01-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A473148-1g |
| cas | 152628-01-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 25g | 292.50 Pln | |
| Ambeed | 100g | 854.31 Pln | |
| Ambeed | 500g | 2812.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A473148 |
Methyl 4-(butanoylamino)-3-methyl-5-nitrobenzoate (CAS 152628-01-8) is a chemical compound with the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. IUPAC name: methyl 4-(butanoylamino)-3-methyl-5-nitrobenzoate. InChIKey: IGCBUUTXGYCQAI-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O5 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | methyl 4-(butanoylamino)-3-methyl-5-nitrobenzoate |
| InChIKey | IGCBUUTXGYCQAI-UHFFFAOYSA-N |
| SMILES | CCCC(=O)NC1=C(C=C(C=C1C)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)