Methyl 4-(piperidin-4-ylcarbamoyl)benzoate hydrochloride, 95%
cas: 1233954-88-5 — see every product listed under this CAS number, including other names
Methyl 4-(piperidin-4-ylcarbamoyl)benzoate hydrochloride, 95% (CAS 1233954-88-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A528721-250mg |
| cas | 1233954-88-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 709.69 Pln | |
| BLDpharm | 100mg | 286.59 Pln | |
| BLDpharm | 250mg | 414.32 Pln | |
| BLDpharm | 1g | 758.65 Pln | |
| Chemat | 100mg | 275.60 Pln | |
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 779.60 Pln | |
| Fluorochem | 100mg | 492.55 Pln | |
| Fluorochem | 250mg | 763.29 Pln | |
| Fluorochem | 1g | 1445.34 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 4-(piperidin-4-ylcarbamoyl)benzoate;hydrochloride (CAS 1233954-88-5) is a chemical compound with the molecular formula C14H19ClN2O3 and a molecular weight of 298.76 g/mol. IUPAC name: methyl 4-(piperidin-4-ylcarbamoyl)benzoate;hydrochloride. InChIKey: WVEQWKGMIVTNBF-UHFFFAOYSA-N.
| Molecular formula | C14H19ClN2O3 |
|---|---|
| Molecular weight | 298.76 g/mol |
| IUPAC name | methyl 4-(piperidin-4-ylcarbamoyl)benzoate;hydrochloride |
| InChIKey | WVEQWKGMIVTNBF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C(=O)NC2CCNCC2.Cl |
Computed by PubChem (NCBI)