Products 1286274-56-3
CAS 1286274-56-3 appears in our catalog under these names: Methyl 3-(4-aminopiperidine-1-carbonyl)benzoate hydrochloride, 95%, Methyl 3-(4-aminopiperidine-1-carbonyl)benzoate hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
Methyl 3-(4-aminopiperidine-1-carbonyl)benzoate;hydrochloride (CAS 1286274-56-3) is a chemical compound with the molecular formula C14H19ClN2O3 and a molecular weight of 298.76 g/mol. IUPAC name: methyl 3-(4-aminopiperidine-1-carbonyl)benzoate;hydrochloride. InChIKey: IRJRCOSKKBJOGU-UHFFFAOYSA-N.
| Molecular formula | C14H19ClN2O3 |
|---|---|
| Molecular weight | 298.76 g/mol |
| IUPAC name | methyl 3-(4-aminopiperidine-1-carbonyl)benzoate;hydrochloride |
| InChIKey | IRJRCOSKKBJOGU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C(=O)N2CCC(CC2)N.Cl |
Computed by PubChem (NCBI)