Products 1233955-35-5

CAS 1233955-35-5 is the registry number for Methyl 3-(piperidin-4-ylcarbamoyl)benzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 3-(piperidin-4-ylcarbamoyl)benzoate;hydrochloride (CAS 1233955-35-5) is a chemical compound with the molecular formula C14H19ClN2O3 and a molecular weight of 298.76 g/mol. IUPAC name: methyl 3-(piperidin-4-ylcarbamoyl)benzoate;hydrochloride. InChIKey: SGKXHHAJIALKSD-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19ClN2O3
Molecular weight298.76 g/mol
IUPAC namemethyl 3-(piperidin-4-ylcarbamoyl)benzoate;hydrochloride
InChIKeySGKXHHAJIALKSD-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=CC(=C1)C(=O)NC2CCNCC2.Cl

Computed by PubChem (NCBI)