Products 2097133-31-6
CAS 2097133-31-6 is the registry number for Methyl 4-(4-Chloro-6-methyl-2-pyrimidinyl)-1-methoxycyclohexanecarboxylate. Offered by: TRC. Available pack sizes: 500mg.
Methyl 4-(4-chloro-6-methylpyrimidin-2-yl)-1-methoxycyclohexane-1-carboxylate (CAS 2097133-31-6) is a chemical compound with the molecular formula C14H19ClN2O3 and a molecular weight of 298.76 g/mol. IUPAC name: methyl 4-(4-chloro-6-methylpyrimidin-2-yl)-1-methoxycyclohexane-1-carboxylate. InChIKey: QKJFOTOEFVUVOE-UHFFFAOYSA-N.
| Molecular formula | C14H19ClN2O3 |
|---|---|
| Molecular weight | 298.76 g/mol |
| IUPAC name | methyl 4-(4-chloro-6-methylpyrimidin-2-yl)-1-methoxycyclohexane-1-carboxylate |
| InChIKey | QKJFOTOEFVUVOE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)C2CCC(CC2)(C(=O)OC)OC)Cl |
Computed by PubChem (NCBI)