Products 1464137-27-6

CAS 1464137-27-6 is the registry number for (R)-Benzyl 2-(3-amino)-2-oxopiperidin-1-yl)acetate hydrochloride salt, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Benzyl 2-[(3R)-3-amino-2-oxopiperidin-1-yl]acetate;hydrochloride (CAS 1464137-27-6) is a chemical compound with the molecular formula C14H19ClN2O3 and a molecular weight of 298.76 g/mol. IUPAC name: benzyl 2-[(3R)-3-amino-2-oxopiperidin-1-yl]acetate;hydrochloride. InChIKey: CCYRPQFFIQSESZ-UTONKHPSSA-N.

Identity
Molecular formulaC14H19ClN2O3
Molecular weight298.76 g/mol
IUPAC namebenzyl 2-[(3R)-3-amino-2-oxopiperidin-1-yl]acetate;hydrochloride
InChIKeyCCYRPQFFIQSESZ-UTONKHPSSA-N
SMILESC1C[C@H](C(=O)N(C1)CC(=O)OCC2=CC=CC=C2)N.Cl

Computed by PubChem (NCBI)