CAS 1464137-27-6 is the registry number for (R)-Benzyl 2-(3-amino)-2-oxopiperidin-1-yl)acetate hydrochloride salt, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Benzyl 2-[(3R)-3-amino-2-oxopiperidin-1-yl]acetate;hydrochloride (CAS 1464137-27-6) is a chemical compound with the molecular formula C14H19ClN2O3 and a molecular weight of 298.76 g/mol. IUPAC name: benzyl 2-[(3R)-3-amino-2-oxopiperidin-1-yl]acetate;hydrochloride. InChIKey: CCYRPQFFIQSESZ-UTONKHPSSA-N.
| Molecular formula | C14H19ClN2O3 |
|---|---|
| Molecular weight | 298.76 g/mol |
| IUPAC name | benzyl 2-[(3R)-3-amino-2-oxopiperidin-1-yl]acetate;hydrochloride |
| InChIKey | CCYRPQFFIQSESZ-UTONKHPSSA-N |
| SMILES | C1C[C@H](C(=O)N(C1)CC(=O)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)