CAS 2719031-91-9 is the registry number for tert-Butyl 3-[(5-chloropyridin-2-yl)oxy]pyrrolidine-1-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl 3-[(5-chloro-2-pyridinyl)oxy]pyrrolidine-1-carboxylate (CAS 2719031-91-9) is a chemical compound with the molecular formula C14H19ClN2O3 and a molecular weight of 298.76 g/mol. IUPAC name: tert-butyl 3-[(5-chloro-2-pyridinyl)oxy]pyrrolidine-1-carboxylate. InChIKey: MVBWTYCCFQFOKT-UHFFFAOYSA-N.
| Molecular formula | C14H19ClN2O3 |
|---|---|
| Molecular weight | 298.76 g/mol |
| IUPAC name | tert-butyl 3-[(5-chloro-2-pyridinyl)oxy]pyrrolidine-1-carboxylate |
| InChIKey | MVBWTYCCFQFOKT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)OC2=NC=C(C=C2)Cl |
Computed by PubChem (NCBI)