cas: 126937-42-6 — see every product listed under this CAS number, including other names
Methyl 4-Boc-1-Cbz-2-piperazinecarboxylate 97% (CAS 126937-42-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A382620-100mg |
| cas | 126937-42-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 281.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A382620 |
1-O-benzyl 4-O-tert-butyl 2-O-methyl piperazine-1,2,4-tricarboxylate (CAS 126937-42-6) is a chemical compound with the molecular formula C19H26N2O6 and a molecular weight of 378.4 g/mol. IUPAC name: 1-O-benzyl 4-O-tert-butyl 2-O-methyl piperazine-1,2,4-tricarboxylate. InChIKey: FUMOVDZJNXKHJM-UHFFFAOYSA-N.
| Molecular formula | C19H26N2O6 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 1-O-benzyl 4-O-tert-butyl 2-O-methyl piperazine-1,2,4-tricarboxylate |
| InChIKey | FUMOVDZJNXKHJM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(C1)C(=O)OC)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)