Methyl 4-amino-2-methyl-5-nitrobenzoate, 95%
cas: 1260848-51-8 — see every product listed under this CAS number, including other names
Methyl 4-amino-2-methyl-5-nitrobenzoate, 95% (CAS 1260848-51-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A186000-250mg |
| cas | 1260848-51-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 414.88 Pln | |
| Ambeed | 1g | 871.00 Pln | |
| Ambeed | 5g | 2890.19 Pln | |
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 362.00 Pln | |
| Chemat | 1g | 818.00 Pln | |
| BLDpharm | 100mg | 275.48 Pln | |
| BLDpharm | 250mg | 442.09 Pln | |
| BLDpharm | 1g | 930.81 Pln | |
| BLDpharm | 5g | 3113.37 Pln | |
| Fluorochem | 100mg | 258.26 Pln | |
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 893.45 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 4-amino-2-methyl-5-nitrobenzoate (CAS 1260848-51-8) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: methyl 4-amino-2-methyl-5-nitrobenzoate. InChIKey: JWLVSMLOEYNNHO-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | methyl 4-amino-2-methyl-5-nitrobenzoate |
| InChIKey | JWLVSMLOEYNNHO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)OC)[N+](=O)[O-])N |
Computed by PubChem (NCBI)