cas: 6021-32-5 — see every product listed under this CAS number, including other names
Methyl 4-bromo-2,3-dimethylbenzoate 95% (CAS 6021-32-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A648165-100mg |
| cas | 6021-32-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 2422.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A648165 |
Methyl 4-bromo-2,3-dimethylbenzoate (CAS 6021-32-5) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: methyl 4-bromo-2,3-dimethylbenzoate. InChIKey: OBGPZONEGQIWOS-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | methyl 4-bromo-2,3-dimethylbenzoate |
| InChIKey | OBGPZONEGQIWOS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C)Br)C(=O)OC |
Computed by PubChem (NCBI)