cas: 6021-32-5 — see every product listed under this CAS number, including other names
Methyl 4-bromo-2,3-dimethylbenzoate, 98%, 98% (CAS 6021-32-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11400I-10g |
| cas | 6021-32-5 |
| size | 10g |
| availability | 60g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 2690.00 Pln | |
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 429.20 Pln | |
| Chemat | 5g | 1374.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-bromo-2,3-dimethylbenzoate (CAS 6021-32-5) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: methyl 4-bromo-2,3-dimethylbenzoate. InChIKey: OBGPZONEGQIWOS-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | methyl 4-bromo-2,3-dimethylbenzoate |
| InChIKey | OBGPZONEGQIWOS-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C)Br)C(=O)OC |
Computed by PubChem (NCBI)