cas: 148893-72-5 — see every product listed under this CAS number, including other names
Methyl 4-chloro-2-fluorobenzoate, 98%, 98% (CAS 148893-72-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112L04-1g |
| cas | 148893-72-5 |
| size | 1g |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 10g | 136.40 Pln | |
| Chemat | 25g | 237.20 Pln | |
| Chemat | 100g | 654.80 Pln | |
| Chemat | 500g | 2270.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-chloro-2-fluorobenzoate (CAS 148893-72-5) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: methyl 4-chloro-2-fluorobenzoate. InChIKey: FBSXNLLHWUMFEW-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | methyl 4-chloro-2-fluorobenzoate |
| InChIKey | FBSXNLLHWUMFEW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)Cl)F |
Computed by PubChem (NCBI)