cas: 220180-55-2 — see every product listed under this CAS number, including other names
Methyl 4-fluorobenzo[b]thiophene-2-carboxylate, 95% (CAS 220180-55-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F240518-100MG |
| cas | 220180-55-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 81.24 Pln | |
| Fluorochem | 500mg | 138.51 Pln | |
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 466.52 Pln | |
| Fluorochem | 10g | 872.63 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-fluoro-1-benzothiophene-2-carboxylate (CAS 220180-55-2) is a chemical compound with the molecular formula C10H7FO2S and a molecular weight of 210.23 g/mol. IUPAC name: methyl 4-fluoro-1-benzothiophene-2-carboxylate. InChIKey: SPZLAMSTAIFDBN-UHFFFAOYSA-N.
| Molecular formula | C10H7FO2S |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | methyl 4-fluoro-1-benzothiophene-2-carboxylate |
| InChIKey | SPZLAMSTAIFDBN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=CC=C2S1)F |
Computed by PubChem (NCBI)