cas: 269410-10-8 — see every product listed under this CAS number, including other names
Methyl 4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 98%, 98% (CAS 269410-10-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118MBL-100mg |
| cas | 269410-10-8 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 818.00 Pln | |
| Chemat | 10g | 1566.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 269410-10-8) is a chemical compound with the molecular formula C15H21BO5 and a molecular weight of 292.14 g/mol. IUPAC name: methyl 4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: BFNCIPMAUSEQIE-UHFFFAOYSA-N.
| Molecular formula | C15H21BO5 |
|---|---|
| Molecular weight | 292.14 g/mol |
| IUPAC name | methyl 4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | BFNCIPMAUSEQIE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(=O)OC)OC |
Computed by PubChem (NCBI)