CAS 1146214-77-8 appears in our catalog under these names: 3-Methoxy-2-(methoxycarbonyl)phenylboronic acid, pinacol ester, 96%, 3-Methoxy-2-(methoxycarbonyl)phenylboronic Acid Pinacol Ester. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g, 500mg.
Methyl 2-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1146214-77-8) is a chemical compound with the molecular formula C15H21BO5 and a molecular weight of 292.14 g/mol. IUPAC name: methyl 2-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: RAGDNDSTZKPURP-UHFFFAOYSA-N.
| Molecular formula | C15H21BO5 |
|---|---|
| Molecular weight | 292.14 g/mol |
| IUPAC name | methyl 2-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | RAGDNDSTZKPURP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)OC)C(=O)OC |
Computed by PubChem (NCBI)