CAS 1265360-45-9 is the registry number for 2-Formyl-3,5-dimethoxyphenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 1265360-45-9) is a chemical compound with the molecular formula C15H21BO5 and a molecular weight of 292.14 g/mol. IUPAC name: 2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: OQGHEZWNSIGSIS-UHFFFAOYSA-N.
| Molecular formula | C15H21BO5 |
|---|---|
| Molecular weight | 292.14 g/mol |
| IUPAC name | 2,4-dimethoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | OQGHEZWNSIGSIS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2C=O)OC)OC |
Computed by PubChem (NCBI)