Products 811841-45-9

CAS 811841-45-9 is the registry number for 4-Acetoxy-3-methoxyphenylboronic acid, pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate (CAS 811841-45-9) is a chemical compound with the molecular formula C15H21BO5 and a molecular weight of 292.14 g/mol. IUPAC name: [2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate. InChIKey: SQWMSVLBTLTANH-UHFFFAOYSA-N.

Identity
Molecular formulaC15H21BO5
Molecular weight292.14 g/mol
IUPAC name[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate
InChIKeySQWMSVLBTLTANH-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OC(=O)C)OC

Computed by PubChem (NCBI)