CAS 917757-44-9 appears in our catalog under these names: 3-Acetoxy-4-methoxyphenylboronic acid, pinacol ester, 95%, 3–Acetoxy–4–methoxyphenylboronic acid pinacol ester, 2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl),phenyl acetate, 96%, 96%, 2-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl acetate, 96%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
[2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate (CAS 917757-44-9) is a chemical compound with the molecular formula C15H21BO5 and a molecular weight of 292.14 g/mol. IUPAC name: [2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate. InChIKey: XNQOYRPBJQKOGV-UHFFFAOYSA-N.
| Molecular formula | C15H21BO5 |
|---|---|
| Molecular weight | 292.14 g/mol |
| IUPAC name | [2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl] acetate |
| InChIKey | XNQOYRPBJQKOGV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OC)OC(=O)C |
Computed by PubChem (NCBI)