CAS 1801514-52-2 appears in our catalog under these names: 2-Ethoxy-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 95%, 2-Ethoxy-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 95%, 95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
2-ethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 1801514-52-2) is a chemical compound with the molecular formula C15H21BO5 and a molecular weight of 292.14 g/mol. IUPAC name: 2-ethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: QYFREVRTNRKAIW-UHFFFAOYSA-N.
| Molecular formula | C15H21BO5 |
|---|---|
| Molecular weight | 292.14 g/mol |
| IUPAC name | 2-ethoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | QYFREVRTNRKAIW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)O)OCC |
Computed by PubChem (NCBI)